| Catalog Number |
ACM42950743 |
| CAS |
42950-74-3 |
| Structure |
 |
| Synonyms |
2-Phenyl-d5-ethan-d4-ol |
| IUPAC Name |
1,1,2,2-tetradeuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethanol |
| Molecular Weight |
131.22 |
| Molecular Formula |
C8HD9O |
| InChI |
InChI=1S/C8H10O/c9-7-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2/i1D,2D,3D,4D,5D,6D2,7D2 |
| InChI Key |
WRMNZCZEMHIOCP-NVLGFDPUSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
C6D5CD2CD2OH |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])([2H])O)[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
60-12-8 |
| Unlabeled Synonyms |
2-(Hydroxyethyl)benzene |
