| Catalog Number |
ACM352534942 |
| CAS |
352534-94-2 |
| Structure |
 |
| Synonyms |
MES-d13; 2-ethanesulfonic acid-d13 |
| IUPAC Name |
deuterio 1,1,2,2-tetradeuterio-2-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)ethanesulfonate |
| Molecular Weight |
208.31 |
| Molecular Formula |
C6D13NO4S |
| InChI |
InChI=1S/C6H13NO4S/c8-12(9,10)6-3-7-1-4-11-5-2-7/h1-6H2,(H,8,9,10)/i1D2,2D2,3D2,4D2,5D2,6D2/hD |
| InChI Key |
SXGZJKUKBWWHRA-ZPJQSATDSA-N |
| Purity |
98 atom % D |
| Exact Mass |
208.13812677 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1(C(OC(C(N1C([2H])([2H])C([2H])([2H])S(=O)(=O)O[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Monoisotopic Mass |
208.13812677 |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Room temperature |
| Unlabeled CAS |
4432-31-9 |
| Unlabeled Synonyms |
MES |
