| Catalog Number |
ACM352431448-1 |
| CAS |
352431-44-8 |
| Structure |
 |
| Synonyms |
2-(Methyl-D2)butanoic-2,3,3,4,4,4-D6 acid-D |
| IUPAC Name |
2,3,3,4,4,4-hexadeuterio-2-(trideuteriomethyl)butanoic acid |
| Molecular Weight |
111.19 |
| Molecular Formula |
C5HD9O2 |
| InChI |
InChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)/i1D3,2D3,3D2,4D |
| InChI Key |
WLAMNBDJUVNPJU-CBZKUFJVSA-N |
| Chemical Formula |
CD3CD2CD(CD3)COOH |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])(C(=O)O)C([2H])([2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
116-53-0 |
| Unlabeled Synonyms |
DL-2-Methylbutyric acid |
