| Catalog Number |
ACM74495695-1 |
| CAS |
74495-69-5 |
| Structure |
 |
| Synonyms |
[2H3]-2-Methoxyphenol |
| IUPAC Name |
2-(trideuteriomethoxy)phenol |
| Molecular Weight |
127.16 |
| Molecular Formula |
C7H5D3O2 |
| InChI |
InChI=1S/C7H8O2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3/i1D3 |
| InChI Key |
LHGVFZTZFXWLCP-FIBGUPNXSA-N |
| Appearance |
Yellow to orange oil |
| Chemical Formula |
CD3OC6H4OH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])OC1=CC=CC=C1O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
90-05-1 |
| Unlabeled Synonyms |
Guaiacol; 2-Hydroxyanisole |
