2-Methoxy-d3-benzaldehyde
| Catalog Number |
ACM56248498 |
| CAS |
56248-49-8 |
| Structure |
 |
| Synonyms |
2-((2)H3)Methoxybenzaldehyde |
| IUPAC Name |
2-(trideuteriomethoxy)benzaldehyde |
| Molecular Weight |
139.17 |
| Molecular Formula |
C8H5D3O2 |
| InChI |
InChI=1S/C8H8O2/c1-10-8-5-3-2-4-7(8)6-9/h2-6H,1H3/i1D3 |
| InChI Key |
PKZJLOCLABXVMC-FIBGUPNXSA-N |
| Purity |
99 atom % D |
| Chemical Formula |
CD3OC6H4CHO |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])OC1=CC=CC=C1C=O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
135-02-4 |
| Unlabeled Synonyms |
o-Methoxybenzaldehyde; 2-Anisaldehyde |
Please kindly note that our products and services are for research use only.
