| Catalog Number |
ACM20189086 |
| CAS |
20189-08-6 |
| Synonyms |
1,2,5-Trideuterio-3-deuteriooxy-4-methoxy-6-methylbenzene |
| IUPAC Name |
1,2,5-trideuterio-3-deuteriooxy-4-methoxy-6-methylbenzene |
| Molecular Weight |
142.19 |
| Molecular Formula |
C8H7D3O2 |
| InChI |
InChI=1S/C8H10O2/c1-6-3-4-7(9)8(5-6)10-2/h3-5,9H,1-2H3/i3D,4D,5D/hD |
| InChI Key |
PETRWTHZSKVLRE-NKWHLQRWSA-N |
| Purity |
98 atom % D |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1C)[2H])OC)O[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
93-51-6 |
| Unlabeled Synonyms |
2-Methoxy-p-cresol; 4-Methylguaiacol; Creosol |
