| Catalog Number |
ACM358731347-1 |
| CAS |
358731-34-7 |
| Structure |
 |
| Synonyms |
2-Methoxy-17beta-estradiol-1,4,16,16,17-D5 |
| IUPAC Name |
(8R,9S,13S,14S,17S)-1,4,16,16,17-pentadeuterio-2-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| Molecular Weight |
307.44 |
| Molecular Formula |
C19H21D5O3 |
| InChI |
InChI=1S/C19H26O3/c1-19-8-7-12-13(15(19)5-6-18(19)21)4-3-11-9-16(20)17(22-2)10-14(11)12/h9-10,12-13,15,18,20-21H,3-8H2,1-2H3/t12-,13+,15-,18-,19-/m0/s1/i6D2,9D,10D,18D |
| InChI Key |
CQOQDQWUFQDJMK-AGCGVRMISA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C2CC[C@@H]3[C@@H](C2=C(C(=C1O)OC)[2H])CC[C@]4([C@H]3CC([C@]4([2H])O)([2H])[2H])C |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store refrigerated |
| Unlabeled CAS |
362-07-2 |
| Unlabeled Synonyms |
1,3,5(10)-Estratrien-2,3,17β-triol 2-Methyl Ether |
