| Catalog Number |
ACM81586972 |
| CAS |
81586-97-2 |
| Structure |
 |
| Synonyms |
[2H4]-2-Hydroxy estrone |
| IUPAC Name |
(8R,9S,13S,14S)-1,4,16,16-tetradeuterio-2,3-dihydroxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one |
| Molecular Weight |
290.39 |
| Molecular Formula |
C18H18D4O3 |
| InChI |
InChI=1S/C18H22O3/c1-18-7-6-11-12(14(18)4-5-17(18)21)3-2-10-8-15(19)16(20)9-13(10)11/h8-9,11-12,14,19-20H,2-7H2,1H3/t11-,12+,14-,18-/m0/s1/i5D2,8D,9D |
| InChI Key |
SWINWPBPEKHUOD-PJZZMCTGSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C2CC[C@@H]3[C@@H](C2=C(C(=C1O)O)[2H])CC[C@]4([C@H]3CC(C4=O)([2H])[2H])C |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store refrigerated |
| Unlabeled CAS |
362-06-1 |
| Unlabeled Synonyms |
1,3,5(10)-Estratrien-2,3-diol-17-one |
