| Catalog Number |
ACM202480759-1 |
| CAS |
202480-75-9 |
| Structure |
 |
| Synonyms |
[2H17]-2-Ethyl-1-hexanol |
| IUPAC Name |
1,1,2,3,3,4,4,5,5,6,6,6-dodecadeuterio-2-(1,1,2,2,2-pentadeuterioethyl)hexan-1-ol |
| Molecular Weight |
147.33 |
| Molecular Formula |
C8HD17O |
| InChI |
InChI=1S/C8H18O/c1-3-5-6-8(4-2)7-9/h8-9H,3-7H2,1-2H3/i1D3,2D3,3D2,4D2,5D2,6D2,7D2,8D |
| InChI Key |
YIWUKEYIRIRTPP-MMDJZGHJSA-N |
| Chemical Formula |
CD3(CD2)3CD(CD2CD3)CD2OH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
104-76-7 |
| Unlabeled Synonyms |
2-Ethyl-1-hexanol |
