2-Deoxy-D-ribose (5,5-D2)
| Catalog Number |
ACM478511681 |
| CAS |
478511-68-1 |
| Structure |
 |
| Synonyms |
2-Deoxy-D-ribose-5,5'-D2 |
| IUPAC Name |
6,6-dideuteriooxane-2,4,5-triol |
| Molecular Weight |
136.10 |
| Molecular Formula |
C5D2H8O4 |
| InChI |
InChI=1S/C5H10O4/c6-3-1-5(8)9-2-4(3)7/h3-8H,1-2H2/i2D2 |
| InChI Key |
ZVQAVWAHRUNNPG-CBTSVUPCSA-N |
| Melting Point |
89-90 °C (192-194 °F) (lit.) |
| Purity |
98%+ |
| Appearance |
White powder |
| Isomeric SMILES |
[2H]C1(C(C(CC(O1)O)O)O)[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
533-67-5 |
| Unlabeled Synonyms |
2-Deoxy-D-erythropentose; Thyminose; 2-Deoxy-D-arabinose |
Please kindly note that our products and services are for research use only.
