| Catalog Number |
ACM1219803969 |
| CAS |
1219803-96-9 |
| Structure |
 |
| Synonyms |
2-Butoxyethanol-[1,1,2,2-D4] |
| IUPAC Name |
2-butoxy-1,1,2,2-tetradeuterioethanol |
| Molecular Weight |
122.20 |
| Molecular Formula |
C6H10D4O2 |
| InChI |
InChI=1S/C6H14O2/c1-2-3-5-8-6-4-7/h7H,2-6H2,1H3/i4D2,6D2 |
| InChI Key |
POAOYUHQDCAZBD-WVTKESLNSA-N |
| Purity |
99 atom % D |
| Chemical Formula |
CH3CH2CH2CH2OCD2CD2OH |
| Exact Mass |
122.124486669 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C([2H])([2H])OCCCC)O |
| Isotopic Enrichment |
99 atom % D |
| Monoisotopic Mass |
122.124486669 |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Room temperature |
| Unlabeled CAS |
111-76-2 |
| Unlabeled Synonyms |
Ethylene glycol monobutyl ether; Butyl cellosolve |
