Catalog Number |
ACM64502994 |
CAS |
64502-99-4 |
Structure |
|
Synonyms |
2,6-Bis[1,1-di(methyl-d3)ethyl-2,2,2-d3]-4-methylphen-3,5-d2-ol-d |
IUPAC Name |
1,5-dideuterio-3-deuteriooxy-2,4-bis[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-6-methylbenzene |
Molecular Weight |
241.48 |
Molecular Formula |
C15H3D21O |
InChI |
InChI=1S/C15H24O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7/h8-9,16H,1-7H3/i2D3,3D3,4D3,5D3,6D3,7D3,8D,9D/hD |
InChI Key |
NLZUEZXRPGMBCV-YLENQQAOSA-N |
Boiling Point |
265 °C (lit.) |
Melting Point |
69-71 °C (lit.) |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])O[2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H])C |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
Unlabeled CAS |
128-37-0 |
Unlabeled Synonyms |
2,6-Di-tert-butyl-p-cresol; Butylated hydroxytoluene; BHT |