Catalog Number |
ACM1219799344 |
CAS |
1219799-34-4 |
Synonyms |
Dibutylated Hydroxyanisole-d20; [2H20]-Dibutylated Hydroxyanisole |
IUPAC Name |
3,5-dideuterio-2,6-bis[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-4-methoxyphenol |
Molecular Weight |
256.48 |
Molecular Formula |
C15H4D20O2 |
InChI |
InChI=1S/C15H24O2/c1-14(2,3)11-8-10(17-7)9-12(13(11)16)15(4,5)6/h8-9,16H,1-7H3/i1D3,2D3,3D3,4D3,5D3,6D3,8D,9D |
InChI Key |
SLUKQUGVTITNSY-GPSKCXNOSA-N |
Purity |
98 atom % D |
Appearance |
Waxy solid |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1OC)[2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])O)C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
Unlabeled CAS |
489-01-0 |
Unlabeled Synonyms |
3,5-Di-tert-butyl-4-hydroxyanisole |