| Catalog Number |
ACM105078920-1 |
| CAS |
105078-92-0 |
| Structure |
 |
| Synonyms |
17alpha-Hydroxy pregnenolone-D3; Tert-butyl 4-hydroxybenzoate |
| IUPAC Name |
2,2,2-trideuterio-1-[(3S,8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| Molecular Weight |
335.50 |
| Molecular Formula |
C21H29D3O3 |
| InChI |
InChI=1S/C21H32O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h4,15-18,23-24H,5-12H2,1-3H3/t15-,16+,17-,18-,19-,20-,21-/m0/s1/i1D3 |
| InChI Key |
JERGUCIJOXJXHF-DBAXYKBZSA-N |
| Melting Point |
264-267 °C |
| Appearance |
White solid |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C(=O)[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)O |
| Isotopic Enrichment |
97 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
387-79-1 |
| Unlabeled Synonyms |
3β,17α-Dihydroxy-5-pregnen-20-one |
