| Catalog Number |
ACM350820063-1 |
| CAS |
350820-06-3 |
| Structure |
 |
| Synonyms |
(17α)-19-Norpregna-1,3,5(10)-trien-20-yne-3,17-diol-d4; 17α-Ethynylestradiol-d4; Ethinylestradiol-d4 |
| IUPAC Name |
(8R,9S,13S,14S,17R)-2,4,16,16-tetradeuterio-17-ethynyl-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| Molecular Weight |
300.43 |
| Molecular Formula |
C20H20D4O2 |
| InChI |
InChI=1S/C20H24O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h1,5,7,12,16-18,21-22H,4,6,8-11H2,2H3/t16-,17-,18+,19+,20+/m1/s1/i5D,11D2,12D |
| InChI Key |
BFPYWIDHMRZLRN-LJEVPYBISA-N |
| Melting Point |
182-184 °C |
| Appearance |
Pale-yellow solid |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=CC2=C(CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC([C@]4(C#C)O)([2H])[2H])C)C(=C1O)[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
57-63-6 |
| Unlabeled Synonyms |
17α-Ethynyl-1,3,5(10)-estratriene-3,17β-diol; 19-Nor-1,3,5(10),17α-pregnatrien-20-yne-3,17-diol |
