| Catalog Number |
ACM53866334-1 |
| CAS |
53866-33-4 |
| Structure |
 |
| Synonyms |
2,4-Dideuterioestradiol |
| IUPAC Name |
(8R,9S,13S,14S,17S)-2,4-dideuterio-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| Molecular Weight |
274.40 |
| Molecular Formula |
C18H22D2O2 |
| InChI |
InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1/i3D,10D |
| InChI Key |
VOXZDWNPVJITMN-JXCLBMSPSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=CC2=C(CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4O)C)C(=C1O)[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
50-28-2 |
| Unlabeled Synonyms |
3,17β-Dihydroxy-1,3,5(10)-estratriene; 1,3,5-Estratriene-3,17β-diol; Dihydrofolliculin; β-Estradiol |
