| Catalog Number |
ACM79037379-1 |
| CAS |
79037-37-9 |
| Structure |
 |
| Synonyms |
(17)-Estra-1,3,5(10)-triene-3,17-diol-d3; Estradiol-[16,16,17-2H3] |
| IUPAC Name |
(8R,9S,13S,14S,17S)-16,16,17-trideuterio-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| Molecular Weight |
275.40 |
| Molecular Formula |
C18H21D3O2 |
| InChI |
InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1/i7D2,17D |
| InChI Key |
VOXZDWNPVJITMN-SPGJGCHISA-N |
| Melting Point |
178-179 °C (lit.) |
| Appearance |
White crystalline powder |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H][C@]1([C@]2(CC[C@H]3[C@H]([C@@H]2CC1([2H])[2H])CCC4=C3C=CC(=C4)O)C)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
50-28-2 |
| Unlabeled Synonyms |
3,17β-Dihydroxy-1,3,5(10)-estratriene; 1,3,5-Estratriene-3,17β-diol; Dihydrofolliculin; β-Estradiol |
