| Catalog Number |
ACM350819997-1 |
| CAS |
350819-99-7 |
| Structure |
 |
| Synonyms |
17-Dihydroequilin-d4 |
| IUPAC Name |
(13S,14S,17S)-2,4,16,16-tetradeuterio-13-methyl-12,14,15,17-tetrahydro-11H-cyclopenta[a]phenanthrene-3,17-diol |
| Molecular Weight |
274.39 |
| Molecular Formula |
C18H16D4O2 |
| InChI |
InChI=1S/C18H20O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h2-5,10,16-17,19-20H,6-9H2,1H3/t16-,17-,18-/m0/s1/i3D,7D2,10D |
| InChI Key |
RYWZPRVUQHMJFF-GLZVTCTNSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=CC2=C(C=CC3=C2CC[C@]4([C@H]3CC([C@@H]4O)([2H])[2H])C)C(=C1O)[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
3563-27-7 |
| Unlabeled Synonyms |
Estra-1,3,5(10),7-tetraene-3,17-diol |
