| Catalog Number |
ACM350820030-1 |
| CAS |
350820-03-0 |
| Structure |
 |
| Synonyms |
17beta-Dihydro Equilin-16,16,17-D3 |
| IUPAC Name |
(9S,13S,14S,17S)-16,16,17-trideuterio-13-methyl-6,9,11,12,14,15-hexahydrocyclopenta[a]phenanthrene-3,17-diol |
| Molecular Weight |
273.40 |
| Molecular Formula |
C18H17D3O2 |
| InChI |
InChI=1S/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3-5,10,14,16-17,19-20H,2,6-9H2,1H3/t14-,16+,17+,18+/m1/s1/i7D2,17D |
| InChI Key |
NLLMJANWPUQQTA-XPOHSFSVSA-N |
| Melting Point |
173-175 °C |
| Purity |
97% |
| Appearance |
Tan solid |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H][C@]1([C@]2(CC[C@H]3C(=CCC4=C3C=CC(=C4)O)[C@@H]2CC1([2H])[2H])C)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
3563-27-7 |
| Unlabeled Synonyms |
Estra-1,3,5(10),7-tetraene-3,17-diol |
