| Catalog Number |
ACM366495945-1 |
| CAS |
366495-94-5 |
| Structure |
 |
| Synonyms |
(16beta,17beta)-Estra-1,3,5(10)-triene-2,4-D2-3,16,17-triol |
| IUPAC Name |
(8R,9S,13S,14S,16S,17R)-2,4-dideuterio-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol |
| Molecular Weight |
290.40 |
| Molecular Formula |
C18H22D2O3 |
| InChI |
InChI=1S/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16+,17+,18+/m1/s1/i3D,8D |
| InChI Key |
PROQIPRRNZUXQM-FMPUZFRRSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=CC2=C(CC[C@@H]3[C@@H]2CC[C@]4([C@H]3C[C@@H]([C@@H]4O)O)C)C(=C1O)[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
547-81-9 |
| Unlabeled Synonyms |
1,3,5(10)-Estratrien-3,16β,17β-triol; 16-Epiestriol |
