| Catalog Number |
ACM84392074-1 |
| CAS |
84392-07-4 |
| Structure |
 |
| Synonyms |
D4-1-Aminocyclopropane-1-carboxylic acid |
| IUPAC Name |
1-amino-2,2,3,3-tetradeuteriocyclopropane-1-carboxylic acid |
| Molecular Weight |
105.13 |
| Molecular Formula |
C4H3D4NO2 |
| Canonical SMILES |
[2H]C1(C(C1(C(=O)O)N)([2H])[2H])[2H] |
| InChI |
InChI=1S/C4H7NO2/c5-4(1-2-4)3(6)7/h1-2,5H2,(H,6,7)/i1D2,2D2 |
| InChI Key |
PAJPWUMXBYXFCZ-LNLMKGTHSA-N |
| Melting Point |
229-231 °C (lit.) |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
22059-21-8 |
| Unlabeled Synonyms |
α-Aminocyclopropanecarboxylic acid; Acpc-OH |
