| Catalog Number |
ACM1219805465 |
| CAS |
1219805-46-5 |
| IUPAC Name |
1,1,2,2,3,3,4,4-octadeuteriobutane-1,4-dithiol |
| Molecular Weight |
130.29 |
| Molecular Formula |
C4H2D8S2 |
| InChI |
InChI=1S/C4H10S2/c5-3-1-2-4-6/h5-6H,1-4H2/i1D2,2D2,3D2,4D2 |
| InChI Key |
SMTOKHQOVJRXLK-SVYQBANQSA-N |
| Purity |
99 atom % D |
| Chemical Formula |
HS(CD2)4SH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C([2H])([2H])C([2H])([2H])S)C([2H])([2H])S |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
1191-08-8 |
| Unlabeled Synonyms |
1,4-Dimercaptobutane; Tetramethylene dimercaptan |
