| Catalog Number |
ACM52910802-1 |
| CAS |
52910-80-2 |
| Structure |
 |
| Synonyms |
1,2-Propane-1,1,2,3,3,3-d6-diol |
| IUPAC Name |
1,1,2,3,3,3-hexadeuteriopropane-1,2-diol |
| Molecular Weight |
82.13 |
| Molecular Formula |
C3H2D6O2 |
| InChI |
InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3/i1D3,2D2,3D |
| InChI Key |
DNIAPMSPPWPWGF-LIDOUZCJSA-N |
| Boiling Point |
187 °C (lit.) |
| Melting Point |
-60 °C (lit.) |
| Flash Point |
103 °C |
| Density |
1.118 g/mL at 25 °C |
| Chemical Formula |
CD3CD(OH)CD2OH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])(C([2H])([2H])O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
57-55-6 |
| Unlabeled Synonyms |
1,2-Dihydroxypropane |
